C26H32N4O — CID 164625128
N-(piperidin-4-ylmethyl)-5-(4-piperidin-1-ylphenyl)-1H-indole-2-carboxamide (PubChem CID 164625128) has the molecular formula C26H32N4O and a molecular weight of 416.57 g/mol. Its IUPAC name is N-(piperidin-4-ylmethyl)-5-(4-piperidin-1-ylphenyl)-1H-indole-2-carboxamide.
| Compound Name | N-(piperidin-4-ylmethyl)-5-(4-piperidin-1-ylphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 164625128 |
| Molecular Formula | C26H32N4O |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | N-(piperidin-4-ylmethyl)-5-(4-piperidin-1-ylphenyl)-1H-indole-2-carboxamide |
| SMILES | O=C(NCC1CCNCC1)c1cc2cc(-c3ccc(N4CCCCC4)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C26H32N4O/c31-26(28-18-19-10-12-27-13-11-19)25-17-22-16-21(6-9-24(22)29-25)20-4-7-23(8-5-20)30-14-2-1-3-15-30/h4-9,16-17,19,27,29H,1-3,10-15,18H2,(H,28,31) |
| InChIKey | CXVWDWJJGUOPAU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |