C22H38ClN3O — CID 173258924
2-chloro-N-(cyclooctylmethyl)-5-piperazin-1-ylbenzamide;methane (PubChem CID 173258924) has the molecular formula C22H38ClN3O and a molecular weight of 396.02 g/mol. Its IUPAC name is 2-chloro-N-(cyclooctylmethyl)-5-piperazin-1-ylbenzamide;methane.
| Compound Name | 2-chloro-N-(cyclooctylmethyl)-5-piperazin-1-ylbenzamide;methane |
|---|---|
| PubChem CID | 173258924 |
| Molecular Formula | C22H38ClN3O |
| Molecular Weight | 396.02 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | 2-chloro-N-(cyclooctylmethyl)-5-piperazin-1-ylbenzamide;methane |
| SMILES | C.C.O=C(NCC1CCCCCCC1)c1cc(N2CCNCC2)ccc1Cl |
| InChI | InChI=1S/C20H30ClN3O.2CH4/c21-19-9-8-17(24-12-10-22-11-13-24)14-18(19)20(25)23-15-16-6-4-2-1-3-5-7-16;;/h8-9,14,16,22H,1-7,10-13,15H2,(H,23,25);2*1H4 |
| InChIKey | VPRMUOVZAVNFRH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.02 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |