C22H37Cl2NO3 — CID 173256832
2-chloro-5-[2-(2-chloroethoxy)ethoxy]-N-(cyclooctylmethyl)benzamide;methane (PubChem CID 173256832) has the molecular formula C22H37Cl2NO3 and a molecular weight of 434.45 g/mol. Its IUPAC name is 2-chloro-5-[2-(2-chloroethoxy)ethoxy]-N-(cyclooctylmethyl)benzamide;methane.
| Compound Name | 2-chloro-5-[2-(2-chloroethoxy)ethoxy]-N-(cyclooctylmethyl)benzamide;methane |
|---|---|
| PubChem CID | 173256832 |
| Molecular Formula | C22H37Cl2NO3 |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 2-chloro-5-[2-(2-chloroethoxy)ethoxy]-N-(cyclooctylmethyl)benzamide;methane |
| SMILES | C.C.O=C(NCC1CCCCCCC1)c1cc(OCCOCCCl)ccc1Cl |
| InChI | InChI=1S/C20H29Cl2NO3.2CH4/c21-10-11-25-12-13-26-17-8-9-19(22)18(14-17)20(24)23-15-16-6-4-2-1-3-5-7-16;;/h8-9,14,16H,1-7,10-13,15H2,(H,23,24);2*1H4 |
| InChIKey | KPAZXZUUTSRQKC-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|