C15H25N3O3 — CID 108530968
N-cycloheptyl-N'-(piperidine-4-carbonyl)oxamide (PubChem CID 108530968) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-cycloheptyl-N'-(piperidine-4-carbonyl)oxamide.
| Compound Name | N-cycloheptyl-N'-(piperidine-4-carbonyl)oxamide |
|---|---|
| PubChem CID | 108530968 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-cycloheptyl-N'-(piperidine-4-carbonyl)oxamide |
| SMILES | O=C(NC(=O)C1CCNCC1)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C15H25N3O3/c19-13(11-7-9-16-10-8-11)18-15(21)14(20)17-12-5-3-1-2-4-6-12/h11-12,16H,1-10H2,(H,17,20)(H,18,19,21) |
| InChIKey | SARDXPYKXQFSAX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|