C15H29N5O3 — CID 108517732
N-(3-morpholin-4-ylpropyl)-N'-(2-piperazin-1-ylethyl)oxamide (PubChem CID 108517732) has the molecular formula C15H29N5O3 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-N'-(2-piperazin-1-ylethyl)oxamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-N'-(2-piperazin-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 108517732 |
| Molecular Formula | C15H29N5O3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-N'-(2-piperazin-1-ylethyl)oxamide |
| SMILES | O=C(NCCCN1CCOCC1)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C15H29N5O3/c21-14(17-2-1-6-19-10-12-23-13-11-19)15(22)18-5-9-20-7-3-16-4-8-20/h16H,1-13H2,(H,17,21)(H,18,22) |
| InChIKey | XPTHBRKWHACKSE-UHFFFAOYSA-N |
| XLogP | -2.15 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|