C14H23N5O2 — CID 108863767
(Z)-2-cyano-3-morpholin-4-yl-N-(2-piperazin-1-ylethyl)prop-2-enamide (PubChem CID 108863767) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is (Z)-2-cyano-3-morpholin-4-yl-N-(2-piperazin-1-ylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-morpholin-4-yl-N-(2-piperazin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863767 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (Z)-2-cyano-3-morpholin-4-yl-N-(2-piperazin-1-ylethyl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCOCC1)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C14H23N5O2/c15-11-13(12-19-7-9-21-10-8-19)14(20)17-3-6-18-4-1-16-2-5-18/h12,16H,1-10H2,(H,17,20)/b13-12- |
| InChIKey | OKDKNRWCIBPEJH-SEYXRHQNSA-N |
| XLogP | -1.25 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|