C18H23N5O — CID 108864173
(Z)-2-cyano-3-(2,3-dihydroindol-1-yl)-N-(2-piperazin-1-ylethyl)prop-2-enamide (PubChem CID 108864173) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,3-dihydroindol-1-yl)-N-(2-piperazin-1-ylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,3-dihydroindol-1-yl)-N-(2-piperazin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108864173 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (Z)-2-cyano-3-(2,3-dihydroindol-1-yl)-N-(2-piperazin-1-ylethyl)prop-2-enamide |
| SMILES | N#C/C(=C/N1CCc2ccccc21)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C18H23N5O/c19-13-16(14-23-9-5-15-3-1-2-4-17(15)23)18(24)21-8-12-22-10-6-20-7-11-22/h1-4,14,20H,5-12H2,(H,21,24)/b16-14- |
| InChIKey | UDGGJKRDTDNEKM-PEZBUJJGSA-N |
| XLogP | 0.48 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|