C16H20N6O3 — CID 108863621
(Z)-2-cyano-3-(2-nitroanilino)-N-(2-piperazin-1-ylethyl)prop-2-enamide (PubChem CID 108863621) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-nitroanilino)-N-(2-piperazin-1-ylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-nitroanilino)-N-(2-piperazin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863621 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (Z)-2-cyano-3-(2-nitroanilino)-N-(2-piperazin-1-ylethyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccccc1[N+](=O)[O-])C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C16H20N6O3/c17-11-13(12-20-14-3-1-2-4-15(14)22(24)25)16(23)19-7-10-21-8-5-18-6-9-21/h1-4,12,18,20H,5-10H2,(H,19,23)/b13-12- |
| InChIKey | GPTILLKYROSTNR-SEYXRHQNSA-N |
| XLogP | 0.44 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|