C14H14N4O5 — CID 108845787
4-[[(Z)-2-cyano-3-(2-nitroanilino)prop-2-enoyl]amino]butanoic acid (PubChem CID 108845787) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(2-nitroanilino)prop-2-enoyl]amino]butanoic acid.
| Compound Name | 4-[[(Z)-2-cyano-3-(2-nitroanilino)prop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108845787 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(2-nitroanilino)prop-2-enoyl]amino]butanoic acid |
| SMILES | N#C/C(=C/Nc1ccccc1[N+](=O)[O-])C(=O)NCCCC(=O)O |
| InChI | InChI=1S/C14H14N4O5/c15-8-10(14(21)16-7-3-6-13(19)20)9-17-11-4-1-2-5-12(11)18(22)23/h1-2,4-5,9,17H,3,6-7H2,(H,16,21)(H,19,20)/b10-9- |
| InChIKey | BRQDZDQMMLAINB-KTKRTIGZSA-N |
| XLogP | 1.40 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|