C12H11ClN4O3 — CID 108854356
(Z)-N-(2-chloroethyl)-2-cyano-3-(2-nitroanilino)prop-2-enamide (PubChem CID 108854356) has the molecular formula C12H11ClN4O3 and a molecular weight of 294.70 g/mol. Its IUPAC name is (Z)-N-(2-chloroethyl)-2-cyano-3-(2-nitroanilino)prop-2-enamide.
| Compound Name | (Z)-N-(2-chloroethyl)-2-cyano-3-(2-nitroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108854356 |
| Molecular Formula | C12H11ClN4O3 |
| Molecular Weight | 294.70 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | (Z)-N-(2-chloroethyl)-2-cyano-3-(2-nitroanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccccc1[N+](=O)[O-])C(=O)NCCCl |
| InChI | InChI=1S/C12H11ClN4O3/c13-5-6-15-12(18)9(7-14)8-16-10-3-1-2-4-11(10)17(19)20/h1-4,8,16H,5-6H2,(H,15,18)/b9-8- |
| InChIKey | JZLPNMQORTVLQJ-HJWRWDBZSA-N |
| XLogP | 1.77 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.70 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|