C17H21N7O — CID 108864075
(Z)-3-(3H-benzimidazol-5-ylamino)-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide (PubChem CID 108864075) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is (Z)-3-(3H-benzimidazol-5-ylamino)-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide.
| Compound Name | (Z)-3-(3H-benzimidazol-5-ylamino)-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108864075 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (Z)-3-(3H-benzimidazol-5-ylamino)-2-cyano-N-(2-piperazin-1-ylethyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc2nc[nH]c2c1)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C17H21N7O/c18-10-13(17(25)20-5-8-24-6-3-19-4-7-24)11-21-14-1-2-15-16(9-14)23-12-22-15/h1-2,9,11-12,19,21H,3-8H2,(H,20,25)(H,22,23)/b13-11- |
| InChIKey | YWQLBNQKHQLFEF-QBFSEMIESA-N |
| XLogP | 0.40 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|