C17H23N5O2 — CID 108863685
(Z)-2-cyano-3-(4-methoxyanilino)-N-(2-piperazin-1-ylethyl)prop-2-enamide (PubChem CID 108863685) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-methoxyanilino)-N-(2-piperazin-1-ylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-methoxyanilino)-N-(2-piperazin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863685 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (Z)-2-cyano-3-(4-methoxyanilino)-N-(2-piperazin-1-ylethyl)prop-2-enamide |
| SMILES | COc1ccc(N/C=C(/C#N)C(=O)NCCN2CCNCC2)cc1 |
| InChI | InChI=1S/C17H23N5O2/c1-24-16-4-2-15(3-5-16)21-13-14(12-18)17(23)20-8-11-22-9-6-19-7-10-22/h2-5,13,19,21H,6-11H2,1H3,(H,20,23)/b14-13- |
| InChIKey | CUPCKJVKDDAMDM-YPKPFQOOSA-N |
| XLogP | 0.54 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|