C18H24N4O4 — CID 108863060
(Z)-2-cyano-3-(2,4-dimethoxyanilino)-N-(2-morpholin-4-ylethyl)prop-2-enamide (PubChem CID 108863060) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,4-dimethoxyanilino)-N-(2-morpholin-4-ylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,4-dimethoxyanilino)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863060 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (Z)-2-cyano-3-(2,4-dimethoxyanilino)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
| SMILES | COc1ccc(N/C=C(/C#N)C(=O)NCCN2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C18H24N4O4/c1-24-15-3-4-16(17(11-15)25-2)21-13-14(12-19)18(23)20-5-6-22-7-9-26-10-8-22/h3-4,11,13,21H,5-10H2,1-2H3,(H,20,23)/b14-13- |
| InChIKey | VOLXLXOZDSCYMA-YPKPFQOOSA-N |
| XLogP | 0.97 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|