C16H25N5O3 — CID 108863165
1-[(Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]piperidine-4-carboxamide (PubChem CID 108863165) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-[(Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]piperidine-4-carboxamide.
| Compound Name | 1-[(Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 108863165 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-[(Z)-2-cyano-3-(2-morpholin-4-ylethylamino)-3-oxoprop-1-enyl]piperidine-4-carboxamide |
| SMILES | N#C/C(=C/N1CCC(C(N)=O)CC1)C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H25N5O3/c17-11-14(12-21-4-1-13(2-5-21)15(18)22)16(23)19-3-6-20-7-9-24-10-8-20/h12-13H,1-10H2,(H2,18,22)(H,19,23)/b14-12- |
| InChIKey | QRQLXDSTWCCOFL-OWBHPGMISA-N |
| XLogP | -0.96 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|