C15H25N5O4S — CID 108863245
(Z)-2-cyano-3-(4-methylsulfonylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide (PubChem CID 108863245) has the molecular formula C15H25N5O4S and a molecular weight of 371.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-methylsulfonylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-methylsulfonylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108863245 |
| Molecular Formula | C15H25N5O4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (Z)-2-cyano-3-(4-methylsulfonylpiperazin-1-yl)-N-(2-morpholin-4-ylethyl)prop-2-enamide |
| SMILES | CS(=O)(=O)N1CCN(/C=C(/C#N)C(=O)NCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C15H25N5O4S/c1-25(22,23)20-6-4-19(5-7-20)13-14(12-16)15(21)17-2-3-18-8-10-24-11-9-18/h13H,2-11H2,1H3,(H,17,21)/b14-13- |
| InChIKey | VHCHJKIFFYJERZ-YPKPFQOOSA-N |
| XLogP | -1.58 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|