C16H25N5O4S — CID 108815677
(Z)-2-cyano-3-(4-methylsulfonylpiperazin-1-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 108815677) has the molecular formula C16H25N5O4S and a molecular weight of 383.47 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-methylsulfonylpiperazin-1-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-methylsulfonylpiperazin-1-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 108815677 |
| Molecular Formula | C16H25N5O4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (Z)-2-cyano-3-(4-methylsulfonylpiperazin-1-yl)-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | CS(=O)(=O)N1CCN(/C=C(/C#N)C(=O)NCCCN2CCCC2=O)CC1 |
| InChI | InChI=1S/C16H25N5O4S/c1-26(24,25)21-10-8-19(9-11-21)13-14(12-17)16(23)18-5-3-7-20-6-2-4-15(20)22/h13H,2-11H2,1H3,(H,18,23)/b14-13- |
| InChIKey | PJDZZIUPYRGQCC-YPKPFQOOSA-N |
| XLogP | -0.90 |
| TPSA | 113.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|