C11H17ClN4O — CID 108854478
(Z)-N-(2-chloroethyl)-2-cyano-3-(4-methylpiperazin-1-yl)prop-2-enamide (PubChem CID 108854478) has the molecular formula C11H17ClN4O and a molecular weight of 256.74 g/mol. Its IUPAC name is (Z)-N-(2-chloroethyl)-2-cyano-3-(4-methylpiperazin-1-yl)prop-2-enamide.
| Compound Name | (Z)-N-(2-chloroethyl)-2-cyano-3-(4-methylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108854478 |
| Molecular Formula | C11H17ClN4O |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (Z)-N-(2-chloroethyl)-2-cyano-3-(4-methylpiperazin-1-yl)prop-2-enamide |
| SMILES | CN1CCN(/C=C(/C#N)C(=O)NCCCl)CC1 |
| InChI | InChI=1S/C11H17ClN4O/c1-15-4-6-16(7-5-15)9-10(8-13)11(17)14-3-2-12/h9H,2-7H2,1H3,(H,14,17)/b10-9- |
| InChIKey | BDMPVRCCJBIRFW-KTKRTIGZSA-N |
| XLogP | -0.00 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|