C18H27N5O3 — CID 108517876
N'-(2-morpholin-4-ylphenyl)-N-(2-piperazin-1-ylethyl)oxamide (PubChem CID 108517876) has the molecular formula C18H27N5O3 and a molecular weight of 361.45 g/mol. Its IUPAC name is N'-(2-morpholin-4-ylphenyl)-N-(2-piperazin-1-ylethyl)oxamide.
| Compound Name | N'-(2-morpholin-4-ylphenyl)-N-(2-piperazin-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 108517876 |
| Molecular Formula | C18H27N5O3 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | N'-(2-morpholin-4-ylphenyl)-N-(2-piperazin-1-ylethyl)oxamide |
| SMILES | O=C(NCCN1CCNCC1)C(=O)Nc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C18H27N5O3/c24-17(20-7-10-22-8-5-19-6-9-22)18(25)21-15-3-1-2-4-16(15)23-11-13-26-14-12-23/h1-4,19H,5-14H2,(H,20,24)(H,21,25) |
| InChIKey | KLXKWXQQQYLWJH-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|