About 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride
2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride (PubChem CID 118522513) has the molecular formula C13H25ClN2O3
and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride |
| PubChem CID | 118522513 |
| Molecular Formula | C13H25ClN2O3 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride |
| SMILES | CC1(C(=O)OCCN2CCOCC2)CCNCC1.Cl |
| InChI | InChI=1S/C13H24N2O3.ClH/c1-13(2-4-14-5-3-13)12(16)18-11-8-15-6-9-17-10-7-15;/h14H,2-11H2,1H3;1H |
| InChIKey | HVSKAQXWJUKUTK-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride?
The IUPAC name of 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride (CID 118522513) is 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride.
What is the SMILES notation for 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride?
The canonical SMILES for 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride is CC1(C(=O)OCCN2CCOCC2)CCNCC1.Cl.
What is the InChIKey of 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride?
The InChIKey is HVSKAQXWJUKUTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3.ClH/c1-13(2-4-14-5-3-13)12(16)18-11-8-15-6-9-17-10-7-15;/h14H,2-11H2,1H3;1H.
What are the key properties of 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride?
2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride has a molecular weight of 292.81 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 4-methylpiperidine-4-carboxylate;hydrochloride is sourced from PubChem (CID 118522513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).