C12H25NO3 — CID 159132677
methane;2-morpholin-4-ylethyl 2,2-dimethylpropanoate (PubChem CID 159132677) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is methane;2-morpholin-4-ylethyl 2,2-dimethylpropanoate.
| Compound Name | methane;2-morpholin-4-ylethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 159132677 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | methane;2-morpholin-4-ylethyl 2,2-dimethylpropanoate |
| SMILES | C.CC(C)(C)C(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C11H21NO3.CH4/c1-11(2,3)10(13)15-9-6-12-4-7-14-8-5-12;/h4-9H2,1-3H3;1H4 |
| InChIKey | KHCGAUFHKCGDFG-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |