About 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate
2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate (PubChem CID 158502443) has the molecular formula C16H31NO6
and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate |
| PubChem CID | 158502443 |
| Molecular Formula | C16H31NO6 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OCCN1CCOCC1.CC(C)C(=O)OCCO |
| InChI | InChI=1S/C10H19NO3.C6H12O3/c1-9(2)10(12)14-8-5-11-3-6-13-7-4-11;1-5(2)6(8)9-4-3-7/h9H,3-8H2,1-2H3;5,7H,3-4H2,1-2H3 |
| InChIKey | HKBCVGNNMZRMRD-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate?
The IUPAC name of 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate (CID 158502443) is 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate.
What is the SMILES notation for 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate?
The canonical SMILES for 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate is CC(C)C(=O)OCCN1CCOCC1.CC(C)C(=O)OCCO.
What is the InChIKey of 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate?
The InChIKey is HKBCVGNNMZRMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3.C6H12O3/c1-9(2)10(12)14-8-5-11-3-6-13-7-4-11;1-5(2)6(8)9-4-3-7/h9H,3-8H2,1-2H3;5,7H,3-4H2,1-2H3.
What are the key properties of 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate?
2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate has a molecular weight of 333.43 g/mol, XLogP of 0.70, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl 2-methylpropanoate;2-morpholin-4-ylethyl 2-methylpropanoate is sourced from PubChem (CID 158502443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).