About 2-morpholin-4-ylethyl 2-ethylpentanoate
2-morpholin-4-ylethyl 2-ethylpentanoate (PubChem CID 144660148) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 2-ethylpentanoate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 2-ethylpentanoate |
| PubChem CID | 144660148 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-morpholin-4-ylethyl 2-ethylpentanoate |
| SMILES | CCCC(CC)C(=O)OCCN1CCOCC1 |
| InChI | InChI=1S/C13H25NO3/c1-3-5-12(4-2)13(15)17-11-8-14-6-9-16-10-7-14/h12H,3-11H2,1-2H3 |
| InChIKey | SWTCRGFPNCXXHL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-morpholin-4-ylethyl 2-ethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 2-ethylpentanoate?
The IUPAC name of 2-morpholin-4-ylethyl 2-ethylpentanoate (CID 144660148) is 2-morpholin-4-ylethyl 2-ethylpentanoate.
What is the SMILES notation for 2-morpholin-4-ylethyl 2-ethylpentanoate?
The canonical SMILES for 2-morpholin-4-ylethyl 2-ethylpentanoate is CCCC(CC)C(=O)OCCN1CCOCC1.
What is the InChIKey of 2-morpholin-4-ylethyl 2-ethylpentanoate?
The InChIKey is SWTCRGFPNCXXHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-3-5-12(4-2)13(15)17-11-8-14-6-9-16-10-7-14/h12H,3-11H2,1-2H3.
What are the key properties of 2-morpholin-4-ylethyl 2-ethylpentanoate?
2-morpholin-4-ylethyl 2-ethylpentanoate has a molecular weight of 243.35 g/mol, XLogP of 1.69, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 2-ethylpentanoate is sourced from PubChem (CID 144660148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).