C9H14F3NO3 — CID 166930136
2-morpholin-4-ylethyl 3,3,3-trifluoropropanoate (PubChem CID 166930136) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 3,3,3-trifluoropropanoate.
| Compound Name | 2-morpholin-4-ylethyl 3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 166930136 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-morpholin-4-ylethyl 3,3,3-trifluoropropanoate |
| SMILES | O=C(CC(F)(F)F)OCCN1CCOCC1 |
| InChI | InChI=1S/C9H14F3NO3/c10-9(11,12)7-8(14)16-6-3-13-1-4-15-5-2-13/h1-7H2 |
| InChIKey | AJESRXRFXKCZOE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |