2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate

C14H26N2O3 — CID 118534909

IUPAC2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate
SMILESCCN1CCC(C(=O)OCCN2CCOCC2)CC1
InChIInChI=1S/C14H26N2O3/c1-2-15-5-3-13(4-6-15)14(17)19-12-9-16-7-10-18-11-8-16/h13H,2-12H2,1H3
InChIKeyRJHUETTXVBGAII-UHFFFAOYSA-N
MW270.37 g/mol
LogP0.59
Rot. Bonds5

About 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate

2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate (PubChem CID 118534909) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate.

Molecular Properties

Compound Name2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate
PubChem CID118534909
Molecular FormulaC14H26N2O3
Molecular Weight270.37 g/mol
Exact Mass270.19
IUPAC Name2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate
SMILESCCN1CCC(C(=O)OCCN2CCOCC2)CC1
InChIInChI=1S/C14H26N2O3/c1-2-15-5-3-13(4-6-15)14(17)19-12-9-16-7-10-18-11-8-16/h13H,2-12H2,1H3
InChIKeyRJHUETTXVBGAII-UHFFFAOYSA-N
XLogP0.59
TPSA42.01 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.37
LogP ≤ 50.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate?
The IUPAC name of 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate (CID 118534909) is 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate.
What is the SMILES notation for 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate?
The canonical SMILES for 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate is CCN1CCC(C(=O)OCCN2CCOCC2)CC1.
What is the InChIKey of 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate?
The InChIKey is RJHUETTXVBGAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-2-15-5-3-13(4-6-15)14(17)19-12-9-16-7-10-18-11-8-16/h13H,2-12H2,1H3.
What are the key properties of 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate?
2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate has a molecular weight of 270.37 g/mol, XLogP of 0.59, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate is sourced from PubChem (CID 118534909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).