About 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate
2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate (PubChem CID 118534909) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate |
| PubChem CID | 118534909 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate |
| SMILES | CCN1CCC(C(=O)OCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C14H26N2O3/c1-2-15-5-3-13(4-6-15)14(17)19-12-9-16-7-10-18-11-8-16/h13H,2-12H2,1H3 |
| InChIKey | RJHUETTXVBGAII-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate?
The IUPAC name of 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate (CID 118534909) is 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate.
What is the SMILES notation for 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate?
The canonical SMILES for 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate is CCN1CCC(C(=O)OCCN2CCOCC2)CC1.
What is the InChIKey of 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate?
The InChIKey is RJHUETTXVBGAII-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-2-15-5-3-13(4-6-15)14(17)19-12-9-16-7-10-18-11-8-16/h13H,2-12H2,1H3.
What are the key properties of 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate?
2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate has a molecular weight of 270.37 g/mol, XLogP of 0.59, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 1-ethylpiperidine-4-carboxylate is sourced from PubChem (CID 118534909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).