About 2-morpholin-4-ylethyl cyclohexanecarboxylate
2-morpholin-4-ylethyl cyclohexanecarboxylate (PubChem CID 21150298) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl cyclohexanecarboxylate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl cyclohexanecarboxylate |
| PubChem CID | 21150298 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2-morpholin-4-ylethyl cyclohexanecarboxylate |
| SMILES | O=C(OCCN1CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C13H23NO3/c15-13(12-4-2-1-3-5-12)17-11-8-14-6-9-16-10-7-14/h12H,1-11H2 |
| InChIKey | SXEHNUFAMUORRF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-morpholin-4-ylethyl cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl cyclohexanecarboxylate?
The IUPAC name of 2-morpholin-4-ylethyl cyclohexanecarboxylate (CID 21150298) is 2-morpholin-4-ylethyl cyclohexanecarboxylate.
What is the SMILES notation for 2-morpholin-4-ylethyl cyclohexanecarboxylate?
The canonical SMILES for 2-morpholin-4-ylethyl cyclohexanecarboxylate is O=C(OCCN1CCOCC1)C1CCCCC1.
What is the InChIKey of 2-morpholin-4-ylethyl cyclohexanecarboxylate?
The InChIKey is SXEHNUFAMUORRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO3/c15-13(12-4-2-1-3-5-12)17-11-8-14-6-9-16-10-7-14/h12H,1-11H2.
What are the key properties of 2-morpholin-4-ylethyl cyclohexanecarboxylate?
2-morpholin-4-ylethyl cyclohexanecarboxylate has a molecular weight of 241.33 g/mol, XLogP of 1.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl cyclohexanecarboxylate is sourced from PubChem (CID 21150298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).