About [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol
[4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol (PubChem CID 161208476) has the molecular formula C19H36N2O5
and a molecular weight of 372.51 g/mol. Its IUPAC name is [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol |
| PubChem CID | 161208476 |
| Molecular Formula | C19H36N2O5 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol |
| SMILES | O=C(OCN1CCC(CO)CC1)C1CCOCC1.OCC1CCNCC1 |
| InChI | InChI=1S/C13H23NO4.C6H13NO/c15-9-11-1-5-14(6-2-11)10-18-13(16)12-3-7-17-8-4-12;8-5-6-1-3-7-4-2-6/h11-12,15H,1-10H2;6-8H,1-5H2 |
| InChIKey | UVXOGGGQPPCSBJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol?
The IUPAC name of [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol (CID 161208476) is [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol.
What is the SMILES notation for [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol?
The canonical SMILES for [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol is O=C(OCN1CCC(CO)CC1)C1CCOCC1.OCC1CCNCC1.
What is the InChIKey of [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol?
The InChIKey is UVXOGGGQPPCSBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO4.C6H13NO/c15-9-11-1-5-14(6-2-11)10-18-13(16)12-3-7-17-8-4-12;8-5-6-1-3-7-4-2-6/h11-12,15H,1-10H2;6-8H,1-5H2.
What are the key properties of [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol?
[4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol has a molecular weight of 372.51 g/mol, XLogP of 0.60, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)piperidin-1-yl]methyl oxane-4-carboxylate;piperidin-4-ylmethanol is sourced from PubChem (CID 161208476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).