About [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate
[(3S)-pyrrolidin-3-yl] oxane-4-carboxylate (PubChem CID 86319568) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate.
Molecular Properties
| Compound Name | [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate |
| PubChem CID | 86319568 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate |
| SMILES | O=C(O[C@H]1CCNC1)C1CCOCC1 |
| InChI | InChI=1S/C10H17NO3/c12-10(8-2-5-13-6-3-8)14-9-1-4-11-7-9/h8-9,11H,1-7H2/t9-/m0/s1 |
| InChIKey | BDOBMQXXTZITJS-VIFPVBQESA-N |
| XLogP | 0.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate?
The IUPAC name of [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate (CID 86319568) is [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate.
What is the SMILES notation for [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate?
The canonical SMILES for [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate is O=C(O[C@H]1CCNC1)C1CCOCC1.
What is the InChIKey of [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate?
The InChIKey is BDOBMQXXTZITJS-VIFPVBQESA-N. The full InChI is InChI=1S/C10H17NO3/c12-10(8-2-5-13-6-3-8)14-9-1-4-11-7-9/h8-9,11H,1-7H2/t9-/m0/s1.
What are the key properties of [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate?
[(3S)-pyrrolidin-3-yl] oxane-4-carboxylate has a molecular weight of 199.25 g/mol, XLogP of 0.32, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-pyrrolidin-3-yl] oxane-4-carboxylate is sourced from PubChem (CID 86319568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).