C6H9Cl4NO2 — CID 56829478
pyrrolidin-3-yl 2,2,2-trichloroacetate;hydrochloride (PubChem CID 56829478) has the molecular formula C6H9Cl4NO2 and a molecular weight of 268.96 g/mol. Its IUPAC name is pyrrolidin-3-yl 2,2,2-trichloroacetate;hydrochloride.
| Compound Name | pyrrolidin-3-yl 2,2,2-trichloroacetate;hydrochloride |
|---|---|
| PubChem CID | 56829478 |
| Molecular Formula | C6H9Cl4NO2 |
| Molecular Weight | 268.96 g/mol |
| Exact Mass | 266.94 |
| IUPAC Name | pyrrolidin-3-yl 2,2,2-trichloroacetate;hydrochloride |
| SMILES | Cl.O=C(OC1CCNC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8Cl3NO2.ClH/c7-6(8,9)5(11)12-4-1-2-10-3-4;/h4,10H,1-3H2;1H |
| InChIKey | CWHYPGMYDIDRJX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.96 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|