C18H19NO3 — CID 10613945
[(3R)-pyrrolidin-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 10613945) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is [(3R)-pyrrolidin-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-pyrrolidin-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 10613945 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [(3R)-pyrrolidin-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(O[C@@H]1CCNC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c20-17(22-16-11-12-19-13-16)18(21,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16,19,21H,11-13H2/t16-/m1/s1 |
| InChIKey | CECGGRRIGNRBDE-MRXNPFEDSA-N |
| XLogP | 1.83 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |