C23H24O3 — CID 146971372
[(5S)-5-tricyclo[5.2.0.01,3]nonanyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 146971372) has the molecular formula C23H24O3 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(5S)-5-tricyclo[5.2.0.01,3]nonanyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(5S)-5-tricyclo[5.2.0.01,3]nonanyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 146971372 |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | [(5S)-5-tricyclo[5.2.0.01,3]nonanyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(O[C@H]1CC2CCC23CC3C1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24O3/c24-21(26-20-13-18-11-12-22(18)15-19(22)14-20)23(25,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,18-20,25H,11-15H2/t18?,19?,20-,22?/m0/s1 |
| InChIKey | AMMIRXFRNFUBGE-LJYGWVNYSA-N |
| XLogP | 4.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |