C25H31O4+ — CID 177225438
[3-(oxolan-1-ium-1-yl)cycloheptyl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 177225438) has the molecular formula C25H31O4+ and a molecular weight of 395.52 g/mol. Its IUPAC name is [3-(oxolan-1-ium-1-yl)cycloheptyl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [3-(oxolan-1-ium-1-yl)cycloheptyl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 177225438 |
| Molecular Formula | C25H31O4+ |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | [3-(oxolan-1-ium-1-yl)cycloheptyl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(OC1CCCCC([O+]2CCCC2)C1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H31O4/c26-24(28-22-15-7-8-16-23(19-22)29-17-9-10-18-29)25(27,20-11-3-1-4-12-20)21-13-5-2-6-14-21/h1-6,11-14,22-23,27H,7-10,15-19H2/q+1 |
| InChIKey | HLSWNHDIJUIXBR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|