C21H25NO4 — CID 10665893
[(3R)-1-(2-hydroxyethyl)piperidin-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 10665893) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is [(3R)-1-(2-hydroxyethyl)piperidin-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-(2-hydroxyethyl)piperidin-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 10665893 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | [(3R)-1-(2-hydroxyethyl)piperidin-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | O=C(O[C@@H]1CCCN(CCO)C1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO4/c23-15-14-22-13-7-12-19(16-22)26-20(24)21(25,17-8-3-1-4-9-17)18-10-5-2-6-11-18/h1-6,8-11,19,23,25H,7,12-16H2/t19-/m1/s1 |
| InChIKey | DZOLMRGHHKCJPY-LJQANCHMSA-N |
| XLogP | 1.92 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |