C20H24ClNO3 — CID 517443
(1-methylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate chloride (PubChem CID 517443) has the molecular formula C20H24ClNO3 and a molecular weight of 361.87 g/mol. Its IUPAC name is (1-methylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate chloride.
| Compound Name | (1-methylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate chloride |
|---|---|
| PubChem CID | 517443 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (1-methylpiperidin-1-ium-4-yl) 2-hydroxy-2,2-diphenylacetate chloride |
| SMILES | C[NH+]1CCC(OC(=O)C(O)(c2ccccc2)c2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C20H23NO3.ClH/c1-21-14-12-18(13-15-21)24-19(22)20(23,16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18,23H,12-15H2,1H3;1H |
| InChIKey | FHRXLNUDFZNIRG-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |