C20H22N4O3 — CID 92855542
(1-methylpiperidin-4-yl) (2S)-2-(4-azidophenyl)-2-hydroxy-2-phenylacetate (PubChem CID 92855542) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) (2S)-2-(4-azidophenyl)-2-hydroxy-2-phenylacetate.
| Compound Name | (1-methylpiperidin-4-yl) (2S)-2-(4-azidophenyl)-2-hydroxy-2-phenylacetate |
|---|---|
| PubChem CID | 92855542 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (1-methylpiperidin-4-yl) (2S)-2-(4-azidophenyl)-2-hydroxy-2-phenylacetate |
| SMILES | CN1CCC(OC(=O)[C@](O)(c2ccccc2)c2ccc(N=[N+]=[N-])cc2)CC1 |
| InChI | InChI=1S/C20H22N4O3/c1-24-13-11-18(12-14-24)27-19(25)20(26,15-5-3-2-4-6-15)16-7-9-17(10-8-16)22-23-21/h2-10,18,26H,11-14H2,1H3/t20-/m0/s1 |
| InChIKey | DVRVJXRURLHXKP-FQEVSTJZSA-N |
| XLogP | 3.50 |
| TPSA | 98.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|