C23H26NO4+ — CID 11378093
[(2S,4R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 11378093) has the molecular formula C23H26NO4+ and a molecular weight of 380.46 g/mol. Its IUPAC name is [(2S,4R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(2S,4R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 11378093 |
| Molecular Formula | C23H26NO4+ |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | [(2S,4R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(C)C2CC(OC(=O)C(O)(c3ccccc3)c3ccccc3)CC1[C@@H]1O[C@H]21 |
| InChI | InChI=1S/C23H26NO4/c1-24(2)18-13-17(14-19(24)21-20(18)28-21)27-22(25)23(26,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17-21,26H,13-14H2,1-2H3/q+1/t17?,18?,19?,20-,21+ |
| InChIKey | YEKNPVHRXRJUMA-AFQACZAZSA-N |
| XLogP | 2.22 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|