C24H28BrNO3 — CID 11583398
[(4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-diphenylpropanoate bromide (PubChem CID 11583398) has the molecular formula C24H28BrNO3 and a molecular weight of 458.40 g/mol. Its IUPAC name is [(4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-diphenylpropanoate bromide.
| Compound Name | [(4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-diphenylpropanoate bromide |
|---|---|
| PubChem CID | 11583398 |
| Molecular Formula | C24H28BrNO3 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [(4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-diphenylpropanoate bromide |
| SMILES | CC(C(=O)OC1CC2C3O[C@H]3[C@H](C1)[N+]2(C)C)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C24H28NO3.BrH/c1-24(16-10-6-4-7-11-16,17-12-8-5-9-13-17)23(26)27-18-14-19-21-22(28-21)20(15-18)25(19,2)3;/h4-13,18-22H,14-15H2,1-3H3;1H/q+1;/p-1/t18?,19-,20?,21-,22?;/m0./s1 |
| InChIKey | FGZRLWDYYBECKA-PTBTZKMRSA-M |
| XLogP | 0.30 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|