C23H23F3NO3+ — CID 90724014
[(4R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-fluoro-2,2-bis(4-fluorophenyl)acetate (PubChem CID 90724014) has the molecular formula C23H23F3NO3+ and a molecular weight of 418.44 g/mol. Its IUPAC name is [(4R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-fluoro-2,2-bis(4-fluorophenyl)acetate.
| Compound Name | [(4R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-fluoro-2,2-bis(4-fluorophenyl)acetate |
|---|---|
| PubChem CID | 90724014 |
| Molecular Formula | C23H23F3NO3+ |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [(4R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-fluoro-2,2-bis(4-fluorophenyl)acetate |
| SMILES | C[N+]1(C)C2CC(OC(=O)C(F)(c3ccc(F)cc3)c3ccc(F)cc3)CC1[C@H]1OC21 |
| InChI | InChI=1S/C23H23F3NO3/c1-27(2)18-11-17(12-19(27)21-20(18)30-21)29-22(28)23(26,13-3-7-15(24)8-4-13)14-5-9-16(25)10-6-14/h3-10,17-21H,11-12H2,1-2H3/q+1/t17?,18?,19?,20-,21?/m1/s1 |
| InChIKey | LVNLZBSUIMNPGA-DIGXMAGLSA-N |
| XLogP | 3.48 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|