C24H26F2NO4+ — CID 20756876
(9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate (PubChem CID 20756876) has the molecular formula C24H26F2NO4+ and a molecular weight of 430.47 g/mol. Its IUPAC name is (9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate.
| Compound Name | (9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 20756876 |
| Molecular Formula | C24H26F2NO4+ |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (9-ethyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
| SMILES | CC[N+]1(C)C2CC(OC(=O)C(O)(c3ccc(F)cc3)c3ccc(F)cc3)CC1C1OC12 |
| InChI | InChI=1S/C24H26F2NO4/c1-3-27(2)19-12-18(13-20(27)22-21(19)31-22)30-23(28)24(29,14-4-8-16(25)9-5-14)15-6-10-17(26)11-7-15/h4-11,18-22,29H,3,12-13H2,1-2H3/q+1 |
| InChIKey | WRLFMULMVRNFGW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|