C25H26F2NO3+ — CID 163595454
[(8S)-10,10-dimethyl-10-azoniatetracyclo[4.3.1.02,4.02,5]decan-8-yl] 2,2-bis(4-fluorophenyl)-2-hydroxyacetate (PubChem CID 163595454) has the molecular formula C25H26F2NO3+ and a molecular weight of 426.48 g/mol. Its IUPAC name is [(8S)-10,10-dimethyl-10-azoniatetracyclo[4.3.1.02,4.02,5]decan-8-yl] 2,2-bis(4-fluorophenyl)-2-hydroxyacetate.
| Compound Name | [(8S)-10,10-dimethyl-10-azoniatetracyclo[4.3.1.02,4.02,5]decan-8-yl] 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 163595454 |
| Molecular Formula | C25H26F2NO3+ |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [(8S)-10,10-dimethyl-10-azoniatetracyclo[4.3.1.02,4.02,5]decan-8-yl] 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
| SMILES | C[N+]1(C)C2C[C@H](OC(=O)C(O)(c3ccc(F)cc3)c3ccc(F)cc3)CC1C13CC1C23 |
| InChI | InChI=1S/C25H26F2NO3/c1-28(2)20-11-18(12-21(28)24-13-19(24)22(20)24)31-23(29)25(30,14-3-7-16(26)8-4-14)15-5-9-17(27)10-6-15/h3-10,18-22,30H,11-13H2,1-2H3/q+1/t18-,19?,20?,21?,22?,24?/m0/s1 |
| InChIKey | GTAXMKRRMUGVGU-BTABBWLSSA-N |
| XLogP | 3.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|