C23H22Cl2F2NO3+ — CID 20756863
(8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2,2-bis(4-chloro-3-fluorophenyl)-2-hydroxyacetate (PubChem CID 20756863) has the molecular formula C23H22Cl2F2NO3+ and a molecular weight of 469.34 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2,2-bis(4-chloro-3-fluorophenyl)-2-hydroxyacetate.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2,2-bis(4-chloro-3-fluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 20756863 |
| Molecular Formula | C23H22Cl2F2NO3+ |
| Molecular Weight | 469.34 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2,2-bis(4-chloro-3-fluorophenyl)-2-hydroxyacetate |
| SMILES | C[N+]1(C)C2C=CC1CC(OC(=O)C(O)(c1ccc(Cl)c(F)c1)c1ccc(Cl)c(F)c1)C2 |
| InChI | InChI=1S/C23H22Cl2F2NO3/c1-28(2)15-5-6-16(28)12-17(11-15)31-22(29)23(30,13-3-7-18(24)20(26)9-13)14-4-8-19(25)21(27)10-14/h3-10,15-17,30H,11-12H2,1-2H3/q+1 |
| InChIKey | VHVBYKFXHGVCCM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|