C11H18NO2+ — CID 175678801
(8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) acetate (PubChem CID 175678801) has the molecular formula C11H18NO2+ and a molecular weight of 196.27 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) acetate.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) acetate |
|---|---|
| PubChem CID | 175678801 |
| Molecular Formula | C11H18NO2+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) acetate |
| SMILES | CC(=O)OC1CC2C=CC(C1)[N+]2(C)C |
| InChI | InChI=1S/C11H18NO2/c1-8(13)14-11-6-9-4-5-10(7-11)12(9,2)3/h4-5,9-11H,6-7H2,1-3H3/q+1 |
| InChIKey | WAJMGYMNZNYKRA-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|