C10H15BrO4 — CID 134901795
[(1R,3S)-3-acetyloxy-5-bromocyclohexyl] acetate (PubChem CID 134901795) has the molecular formula C10H15BrO4 and a molecular weight of 279.13 g/mol. Its IUPAC name is [(1R,3S)-3-acetyloxy-5-bromocyclohexyl] acetate.
| Compound Name | [(1R,3S)-3-acetyloxy-5-bromocyclohexyl] acetate |
|---|---|
| PubChem CID | 134901795 |
| Molecular Formula | C10H15BrO4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | [(1R,3S)-3-acetyloxy-5-bromocyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(Br)C[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C10H15BrO4/c1-6(12)14-9-3-8(11)4-10(5-9)15-7(2)13/h8-10H,3-5H2,1-2H3/t8?,9-,10+ |
| InChIKey | XDIPQGNWGDYYKO-PBINXNQUSA-N |
| XLogP | 1.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|