C23H24BrCl2NO3 — CID 158589535
[(5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 2,2-bis(3-chlorophenyl)-2-hydroxyacetate bromide (PubChem CID 158589535) has the molecular formula C23H24BrCl2NO3 and a molecular weight of 513.26 g/mol. Its IUPAC name is [(5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 2,2-bis(3-chlorophenyl)-2-hydroxyacetate bromide.
| Compound Name | [(5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 2,2-bis(3-chlorophenyl)-2-hydroxyacetate bromide |
|---|---|
| PubChem CID | 158589535 |
| Molecular Formula | C23H24BrCl2NO3 |
| Molecular Weight | 513.26 g/mol |
| Exact Mass | 511.03 |
| IUPAC Name | [(5S)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 2,2-bis(3-chlorophenyl)-2-hydroxyacetate bromide |
| SMILES | C[N+]1(C)C2C=C[C@@H]1CC(OC(=O)C(O)(c1cccc(Cl)c1)c1cccc(Cl)c1)C2.[Br-] |
| InChI | InChI=1S/C23H24Cl2NO3.BrH/c1-26(2)19-9-10-20(26)14-21(13-19)29-22(27)23(28,15-5-3-7-17(24)11-15)16-6-4-8-18(25)12-16;/h3-12,19-21,28H,13-14H2,1-2H3;1H/q+1;/p-1/t19-,20?,21?;/m1./s1 |
| InChIKey | HYSSXUZIJJQWGB-PQGOZPSJSA-M |
| XLogP | 1.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|