C27H34NO7+ — CID 20756858
(8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2,2-bis(3,4-dimethoxyphenyl)-2-hydroxyacetate (PubChem CID 20756858) has the molecular formula C27H34NO7+ and a molecular weight of 484.57 g/mol. Its IUPAC name is (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2,2-bis(3,4-dimethoxyphenyl)-2-hydroxyacetate.
| Compound Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2,2-bis(3,4-dimethoxyphenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 20756858 |
| Molecular Formula | C27H34NO7+ |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | (8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl) 2,2-bis(3,4-dimethoxyphenyl)-2-hydroxyacetate |
| SMILES | COc1ccc(C(O)(C(=O)OC2CC3C=CC(C2)[N+]3(C)C)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C27H34NO7/c1-28(2)19-9-10-20(28)16-21(15-19)35-26(29)27(30,17-7-11-22(31-3)24(13-17)33-5)18-8-12-23(32-4)25(14-18)34-6/h7-14,19-21,30H,15-16H2,1-6H3/q+1 |
| InChIKey | BKJQCHWJYCAMNR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|