C23H22F4NO4+ — CID 90753505
[(4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-bis(3,5-difluorophenyl)-2-hydroxyacetate (PubChem CID 90753505) has the molecular formula C23H22F4NO4+ and a molecular weight of 452.42 g/mol. Its IUPAC name is [(4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-bis(3,5-difluorophenyl)-2-hydroxyacetate.
| Compound Name | [(4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-bis(3,5-difluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 90753505 |
| Molecular Formula | C23H22F4NO4+ |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | [(4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-bis(3,5-difluorophenyl)-2-hydroxyacetate |
| SMILES | C[N+]1(C)C2CC(OC(=O)C(O)(c3cc(F)cc(F)c3)c3cc(F)cc(F)c3)C[C@H]1[C@H]1OC21 |
| InChI | InChI=1S/C23H22F4NO4/c1-28(2)18-9-17(10-19(28)21-20(18)32-21)31-22(29)23(30,11-3-13(24)7-14(25)4-11)12-5-15(26)8-16(27)6-12/h3-8,17-21,30H,9-10H2,1-2H3/q+1/t17?,18-,19?,20+,21?/m0/s1 |
| InChIKey | ZSLNEKIAAMSGCU-FTTSTGDASA-N |
| XLogP | 2.78 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|