C19H24NO8PS2 — CID 11443204
dihydrogen phosphate;(9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 11443204) has the molecular formula C19H24NO8PS2 and a molecular weight of 489.51 g/mol. Its IUPAC name is dihydrogen phosphate;(9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | dihydrogen phosphate;(9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 11443204 |
| Molecular Formula | C19H24NO8PS2 |
| Molecular Weight | 489.51 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | dihydrogen phosphate;(9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | C[N+]1(C)C2CC(OC(=O)C(O)(c3cccs3)c3cccs3)CC1C1OC12.O=P([O-])(O)O |
| InChI | InChI=1S/C19H22NO4S2.H3O4P/c1-20(2)12-9-11(10-13(20)17-16(12)24-17)23-18(21)19(22,14-5-3-7-25-14)15-6-4-8-26-15;1-5(2,3)4/h3-8,11-13,16-17,22H,9-10H2,1-2H3;(H3,1,2,3,4)/q+1;/p-1 |
| InChIKey | AFGXLUKBUPUCNN-UHFFFAOYSA-M |
| XLogP | 0.79 |
| TPSA | 139.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.51 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|