C20H24BrNO4S2 — CID 72712267
[(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2,2-dithiophen-2-ylpropanoate bromide (PubChem CID 72712267) has the molecular formula C20H24BrNO4S2 and a molecular weight of 486.45 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2,2-dithiophen-2-ylpropanoate bromide.
| Compound Name | [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2,2-dithiophen-2-ylpropanoate bromide |
|---|---|
| PubChem CID | 72712267 |
| Molecular Formula | C20H24BrNO4S2 |
| Molecular Weight | 486.45 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | [(1S,2S,4R,5R)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2,2-dithiophen-2-ylpropanoate bromide |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)C(CO)(c3cccs3)c3cccs3)C[C@H]1[C@@H]1O[C@@H]12.[Br-] |
| InChI | InChI=1S/C20H24NO4S2.BrH/c1-21(2)13-9-12(10-14(21)18-17(13)25-18)24-19(23)20(11-22,15-5-3-7-26-15)16-6-4-8-27-16;/h3-8,12-14,17-18,22H,9-11H2,1-2H3;1H/q+1;/p-1/t12?,13-,14+,17-,18+; |
| InChIKey | SZWUZKLDNSNZQH-SHVHSBQUSA-M |
| XLogP | -0.61 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.45 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|