C25H25Br2NO4S2 — CID 25097640
[9-[(4-bromophenyl)methyl]-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide (PubChem CID 25097640) has the molecular formula C25H25Br2NO4S2 and a molecular weight of 627.42 g/mol. Its IUPAC name is [9-[(4-bromophenyl)methyl]-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide.
| Compound Name | [9-[(4-bromophenyl)methyl]-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 25097640 |
| Molecular Formula | C25H25Br2NO4S2 |
| Molecular Weight | 627.42 g/mol |
| Exact Mass | 624.96 |
| IUPAC Name | [9-[(4-bromophenyl)methyl]-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
| SMILES | C[N+]1(Cc2ccc(Br)cc2)C2CC(OC(=O)C(O)(c3cccs3)c3cccs3)CC1C1OC12.[Br-] |
| InChI | InChI=1S/C25H25BrNO4S2.BrH/c1-27(14-15-6-8-16(26)9-7-15)18-12-17(13-19(27)23-22(18)31-23)30-24(28)25(29,20-4-2-10-32-20)21-5-3-11-33-21;/h2-11,17-19,22-23,29H,12-14H2,1H3;1H/q+1;/p-1 |
| InChIKey | YAAUIRDHJHZILH-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|