C22H23Cl3NO6S2+ — CID 59773320
[(1S,2R,4S,5R)-9-methyl-9-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 59773320) has the molecular formula C22H23Cl3NO6S2+ and a molecular weight of 567.92 g/mol. Its IUPAC name is [(1S,2R,4S,5R)-9-methyl-9-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(1S,2R,4S,5R)-9-methyl-9-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 59773320 |
| Molecular Formula | C22H23Cl3NO6S2+ |
| Molecular Weight | 567.92 g/mol |
| Exact Mass | 566.00 |
| IUPAC Name | [(1S,2R,4S,5R)-9-methyl-9-[2-oxo-2-(2,2,2-trichloroethoxy)ethyl]-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | C[N+]1(CC(=O)OCC(Cl)(Cl)Cl)[C@@H]2CC(OC(=O)C(O)(c3cccs3)c3cccs3)C[C@H]1[C@H]1O[C@H]12 |
| InChI | InChI=1S/C22H23Cl3NO6S2/c1-26(10-17(27)30-11-21(23,24)25)13-8-12(9-14(26)19-18(13)32-19)31-20(28)22(29,15-4-2-6-33-15)16-5-3-7-34-16/h2-7,12-14,18-19,29H,8-11H2,1H3/q+1/t12?,13-,14+,18+,19-,26? |
| InChIKey | LKSLUKFKGXBERS-IJRNGHRXSA-N |
| XLogP | 3.63 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.92 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|