C17H17NO4S2 — CID 89484878
3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 89484878) has the molecular formula C17H17NO4S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | 3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 89484878 |
| Molecular Formula | C17H17NO4S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 3-oxa-9-azatricyclo[3.3.1.02,4]nonan-7-yl 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | O=C(OC1CC2NC(C1)C1OC21)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C17H17NO4S2/c19-16(21-9-7-10-14-15(22-14)11(8-9)18-10)17(20,12-3-1-5-23-12)13-4-2-6-24-13/h1-6,9-11,14-15,18,20H,7-8H2 |
| InChIKey | AFMBTKILAQSPNP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|